C22H28N2O10 — CID 167471229
3-[2-[2-[2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 167471229) has the molecular formula C22H28N2O10 and a molecular weight of 480.47 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 167471229 |
| Molecular Formula | C22H28N2O10 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 3-[2-[2-[2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCOCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1O)C2=O |
| InChI | InChI=1S/C22H28N2O10/c25-17-5-4-15(20(28)23-17)24-21(29)14-2-1-3-16(19(14)22(24)30)34-13-12-33-11-10-32-9-8-31-7-6-18(26)27/h1-3,15,20,28H,4-13H2,(H,23,25)(H,26,27) |
| InChIKey | SQMOOXLZUYQBKX-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|