C21H19N3O6 — CID 134571952
2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-phenylacetamide (PubChem CID 134571952) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is 2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-phenylacetamide.
| Compound Name | 2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-phenylacetamide |
|---|---|
| PubChem CID | 134571952 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-phenylacetamide |
| SMILES | O=C(COc1cccc2c1C(=O)N(C1CCC(=O)NC1O)C2=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H19N3O6/c25-16-10-9-14(19(27)23-16)24-20(28)13-7-4-8-15(18(13)21(24)29)30-11-17(26)22-12-5-2-1-3-6-12/h1-8,14,19,27H,9-11H2,(H,22,26)(H,23,25) |
| InChIKey | WOGIPOSXAZYTPN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|