C25H35N3O5 — CID 153358744
4-[3-[3-cyclopentylpropyl(methyl)amino]propoxy]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 153358744) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is 4-[3-[3-cyclopentylpropyl(methyl)amino]propoxy]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[3-[3-cyclopentylpropyl(methyl)amino]propoxy]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 153358744 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 4-[3-[3-cyclopentylpropyl(methyl)amino]propoxy]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CN(CCCOc1cccc2c1C(=O)N(C1CCC(=O)NC1O)C2=O)CCCC1CCCC1 |
| InChI | InChI=1S/C25H35N3O5/c1-27(14-5-9-17-7-2-3-8-17)15-6-16-33-20-11-4-10-18-22(20)25(32)28(24(18)31)19-12-13-21(29)26-23(19)30/h4,10-11,17,19,23,30H,2-3,5-9,12-16H2,1H3,(H,26,29) |
| InChIKey | AQPKGCQHXXLKID-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|