C20H23N3O6 — CID 139373743
tert-butyl N-[(E)-2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethenyl]carbamate (PubChem CID 139373743) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is tert-butyl N-[(E)-2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethenyl]carbamate.
| Compound Name | tert-butyl N-[(E)-2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethenyl]carbamate |
|---|---|
| PubChem CID | 139373743 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | tert-butyl N-[(E)-2-[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C=C/c1cccc2c1C(=O)N(C1CCC(=O)NC1O)C2=O |
| InChI | InChI=1S/C20H23N3O6/c1-20(2,3)29-19(28)21-10-9-11-5-4-6-12-15(11)18(27)23(17(12)26)13-7-8-14(24)22-16(13)25/h4-6,9-10,13,16,25H,7-8H2,1-3H3,(H,21,28)(H,22,24)/b10-9+ |
| InChIKey | FFWKJRAGNIIKTO-MDZDMXLPSA-N |
| XLogP | 1.38 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|