C25H36N4O7 — CID 171510890
tert-butyl N-[2-[2-[2-[[2-(2-methyl-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 171510890) has the molecular formula C25H36N4O7 and a molecular weight of 504.58 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[[2-(2-methyl-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[[2-(2-methyl-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 171510890 |
| Molecular Formula | C25H36N4O7 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[[2-(2-methyl-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC1NC(=O)CCC1N1C(=O)c2cccc(NCCOCCOCCNC(=O)OC(C)(C)C)c2C1=O |
| InChI | InChI=1S/C25H36N4O7/c1-16-19(8-9-20(30)28-16)29-22(31)17-6-5-7-18(21(17)23(29)32)26-10-12-34-14-15-35-13-11-27-24(33)36-25(2,3)4/h5-7,16,19,26H,8-15H2,1-4H3,(H,27,33)(H,28,30) |
| InChIKey | PZKYPAKLURTQBJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|