C21H28N4O6 — CID 166982467
tert-butyl N-[3-[[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]carbamate (PubChem CID 166982467) has the molecular formula C21H28N4O6 and a molecular weight of 432.48 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 166982467 |
| Molecular Formula | C21H28N4O6 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | tert-butyl N-[3-[[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1O)C2=O |
| InChI | InChI=1S/C21H28N4O6/c1-21(2,3)31-20(30)23-11-5-10-22-13-7-4-6-12-16(13)19(29)25(18(12)28)14-8-9-15(26)24-17(14)27/h4,6-7,14,17,22,27H,5,8-11H2,1-3H3,(H,23,30)(H,24,26) |
| InChIKey | RILMIGMGBDKBRL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|