C20H21N3O6 — CID 139370889
tert-butyl N-[(E)-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethenyl]carbamate (PubChem CID 139370889) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is tert-butyl N-[(E)-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethenyl]carbamate.
| Compound Name | tert-butyl N-[(E)-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethenyl]carbamate |
|---|---|
| PubChem CID | 139370889 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | tert-butyl N-[(E)-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]ethenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C=C/c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H21N3O6/c1-20(2,3)29-19(28)21-10-9-11-5-4-6-12-15(11)18(27)23(17(12)26)13-7-8-14(24)22-16(13)25/h4-6,9-10,13H,7-8H2,1-3H3,(H,21,28)(H,22,24,25)/b10-9+ |
| InChIKey | UBNGCDHTFUHNQV-MDZDMXLPSA-N |
| XLogP | 1.58 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|