C20H22N2O7 — CID 175590133
tert-butyl 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypropanoate (PubChem CID 175590133) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is tert-butyl 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypropanoate.
| Compound Name | tert-butyl 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypropanoate |
|---|---|
| PubChem CID | 175590133 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | tert-butyl 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxypropanoate |
| SMILES | CC(Oc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H22N2O7/c1-10(19(27)29-20(2,3)4)28-13-7-5-6-11-15(13)18(26)22(17(11)25)12-8-9-14(23)21-16(12)24/h5-7,10,12H,8-9H2,1-4H3,(H,21,23,24) |
| InChIKey | JEXBJRUPSJNKKK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|