C20H22N2O7 — CID 172633469
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyheptanoic acid (PubChem CID 172633469) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyheptanoic acid.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyheptanoic acid |
|---|---|
| PubChem CID | 172633469 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyheptanoic acid |
| SMILES | CCCCCC(Oc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)C(=O)O |
| InChI | InChI=1S/C20H22N2O7/c1-2-3-4-7-14(20(27)28)29-13-8-5-6-11-16(13)19(26)22(18(11)25)12-9-10-15(23)21-17(12)24/h5-6,8,12,14H,2-4,7,9-10H2,1H3,(H,27,28)(H,21,23,24) |
| InChIKey | XCZUMHUWUQKROV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|