C26H29IN4O6 — CID 167088649
N-[2-[2-[3-acetyl-2-[(2,6-dioxopiperidin-3-yl)carbamoyl]anilino]ethoxy]ethyl]-2-iodo-3-methylbenzamide (PubChem CID 167088649) has the molecular formula C26H29IN4O6 and a molecular weight of 620.44 g/mol. Its IUPAC name is N-[2-[2-[3-acetyl-2-[(2,6-dioxopiperidin-3-yl)carbamoyl]anilino]ethoxy]ethyl]-2-iodo-3-methylbenzamide.
| Compound Name | N-[2-[2-[3-acetyl-2-[(2,6-dioxopiperidin-3-yl)carbamoyl]anilino]ethoxy]ethyl]-2-iodo-3-methylbenzamide |
|---|---|
| PubChem CID | 167088649 |
| Molecular Formula | C26H29IN4O6 |
| Molecular Weight | 620.44 g/mol |
| Exact Mass | 620.11 |
| IUPAC Name | N-[2-[2-[3-acetyl-2-[(2,6-dioxopiperidin-3-yl)carbamoyl]anilino]ethoxy]ethyl]-2-iodo-3-methylbenzamide |
| SMILES | CC(=O)c1cccc(NCCOCCNC(=O)c2cccc(C)c2I)c1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C26H29IN4O6/c1-15-5-3-7-18(23(15)27)24(34)29-12-14-37-13-11-28-19-8-4-6-17(16(2)32)22(19)26(36)30-20-9-10-21(33)31-25(20)35/h3-8,20,28H,9-14H2,1-2H3,(H,29,34)(H,30,36)(H,31,33,35) |
| InChIKey | BTMSRRPRCFCCTB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|