C21H29N5O4 — CID 167463149
4-[[4-(4-aminopiperidin-1-yl)-4-oxobutyl]amino]-N-(2,6-dioxopiperidin-3-yl)benzamide (PubChem CID 167463149) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 4-[[4-(4-aminopiperidin-1-yl)-4-oxobutyl]amino]-N-(2,6-dioxopiperidin-3-yl)benzamide.
| Compound Name | 4-[[4-(4-aminopiperidin-1-yl)-4-oxobutyl]amino]-N-(2,6-dioxopiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 167463149 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 4-[[4-(4-aminopiperidin-1-yl)-4-oxobutyl]amino]-N-(2,6-dioxopiperidin-3-yl)benzamide |
| SMILES | NC1CCN(C(=O)CCCNc2ccc(C(=O)NC3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C21H29N5O4/c22-15-9-12-26(13-10-15)19(28)2-1-11-23-16-5-3-14(4-6-16)20(29)24-17-7-8-18(27)25-21(17)30/h3-6,15,17,23H,1-2,7-13,22H2,(H,24,29)(H,25,27,30) |
| InChIKey | CVSIBVRGNNPXBL-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|