C28H40N6O6 — CID 167463444
tert-butyl N-[1-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]phenyl]piperazin-1-yl]acetyl]piperidin-4-yl]carbamate (PubChem CID 167463444) has the molecular formula C28H40N6O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]phenyl]piperazin-1-yl]acetyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]phenyl]piperazin-1-yl]acetyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 167463444 |
| Molecular Formula | C28H40N6O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | tert-butyl N-[1-[2-[4-[4-[(2,6-dioxopiperidin-3-yl)carbamoyl]phenyl]piperazin-1-yl]acetyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)CN2CCN(c3ccc(C(=O)NC4CCC(=O)NC4=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H40N6O6/c1-28(2,3)40-27(39)29-20-10-12-34(13-11-20)24(36)18-32-14-16-33(17-15-32)21-6-4-19(5-7-21)25(37)30-22-8-9-23(35)31-26(22)38/h4-7,20,22H,8-18H2,1-3H3,(H,29,39)(H,30,37)(H,31,35,38) |
| InChIKey | BBHBKHBXPZTORV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|