C12H15N3O3 — CID 114936796
3-[(6-methoxy-3-pyridinyl)methylamino]piperidine-2,6-dione (PubChem CID 114936796) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-[(6-methoxy-3-pyridinyl)methylamino]piperidine-2,6-dione.
| Compound Name | 3-[(6-methoxy-3-pyridinyl)methylamino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 114936796 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 3-[(6-methoxy-3-pyridinyl)methylamino]piperidine-2,6-dione |
| SMILES | COc1ccc(CNC2CCC(=O)NC2=O)cn1 |
| InChI | InChI=1S/C12H15N3O3/c1-18-11-5-2-8(7-14-11)6-13-9-3-4-10(16)15-12(9)17/h2,5,7,9,13H,3-4,6H2,1H3,(H,15,16,17) |
| InChIKey | DYKGRKFHYCKGSW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|