C16H23N3O4 — CID 177365985
2-hydroxy-3-(propan-2-ylamino)benzaldehyde;3-(methylamino)piperidine-2,6-dione (PubChem CID 177365985) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-hydroxy-3-(propan-2-ylamino)benzaldehyde;3-(methylamino)piperidine-2,6-dione.
| Compound Name | 2-hydroxy-3-(propan-2-ylamino)benzaldehyde;3-(methylamino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 177365985 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-hydroxy-3-(propan-2-ylamino)benzaldehyde;3-(methylamino)piperidine-2,6-dione |
| SMILES | CC(C)Nc1cccc(C=O)c1O.CNC1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H13NO2.C6H10N2O2/c1-7(2)11-9-5-3-4-8(6-12)10(9)13;1-7-4-2-3-5(9)8-6(4)10/h3-7,11,13H,1-2H3;4,7H,2-3H2,1H3,(H,8,9,10) |
| InChIKey | HAGMRPKXVNIQGX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|