C17H24HgN4O4 — CID 143421285
[3-[(2-aminoacetyl)amino]-2-methylphenyl]methylidenemercury;formaldehyde;3-(methylamino)piperidine-2,6-dione (PubChem CID 143421285) has the molecular formula C17H24HgN4O4 and a molecular weight of 548.99 g/mol. Its IUPAC name is [3-[(2-aminoacetyl)amino]-2-methylphenyl]methylidenemercury;formaldehyde;3-(methylamino)piperidine-2,6-dione.
| Compound Name | [3-[(2-aminoacetyl)amino]-2-methylphenyl]methylidenemercury;formaldehyde;3-(methylamino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 143421285 |
| Molecular Formula | C17H24HgN4O4 |
| Molecular Weight | 548.99 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | [3-[(2-aminoacetyl)amino]-2-methylphenyl]methylidenemercury;formaldehyde;3-(methylamino)piperidine-2,6-dione |
| SMILES | C=O.CNC1CCC(=O)NC1=O.Cc1c(C=[Hg])cccc1NC(=O)CN |
| InChI | InChI=1S/C10H12N2O.C6H10N2O2.CH2O.Hg/c1-7-4-3-5-9(8(7)2)12-10(13)6-11;1-7-4-2-3-5(9)8-6(4)10;1-2;/h1,3-5H,6,11H2,2H3,(H,12,13);4,7H,2-3H2,1H3,(H,8,9,10);1H2; |
| InChIKey | XVOATFXYIDITJJ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.99 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|