C24H36N4O6 — CID 167048898
N-[8-[2-[[(2,6-dioxopiperidin-3-yl)amino]-hydroxymethyl]-3-formylanilino]octyl]-2-methoxyacetamide (PubChem CID 167048898) has the molecular formula C24H36N4O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is N-[8-[2-[[(2,6-dioxopiperidin-3-yl)amino]-hydroxymethyl]-3-formylanilino]octyl]-2-methoxyacetamide.
| Compound Name | N-[8-[2-[[(2,6-dioxopiperidin-3-yl)amino]-hydroxymethyl]-3-formylanilino]octyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 167048898 |
| Molecular Formula | C24H36N4O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | N-[8-[2-[[(2,6-dioxopiperidin-3-yl)amino]-hydroxymethyl]-3-formylanilino]octyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NCCCCCCCCNc1cccc(C=O)c1C(O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H36N4O6/c1-34-16-21(31)26-14-7-5-3-2-4-6-13-25-18-10-8-9-17(15-29)22(18)24(33)27-19-11-12-20(30)28-23(19)32/h8-10,15,19,24-25,27,33H,2-7,11-14,16H2,1H3,(H,26,31)(H,28,30,32) |
| InChIKey | FVVGPZCTWATVEX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|