C13H16N2O4 — CID 107711048
3-[1-(2,6-dihydroxyphenyl)ethylamino]piperidine-2,6-dione (PubChem CID 107711048) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-[1-(2,6-dihydroxyphenyl)ethylamino]piperidine-2,6-dione.
| Compound Name | 3-[1-(2,6-dihydroxyphenyl)ethylamino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 107711048 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-[1-(2,6-dihydroxyphenyl)ethylamino]piperidine-2,6-dione |
| SMILES | CC(NC1CCC(=O)NC1=O)c1c(O)cccc1O |
| InChI | InChI=1S/C13H16N2O4/c1-7(12-9(16)3-2-4-10(12)17)14-8-5-6-11(18)15-13(8)19/h2-4,7-8,14,16-17H,5-6H2,1H3,(H,15,18,19) |
| InChIKey | BRZDDDLLYSITAU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|