C12H13FN2O3 — CID 177240512
3-[[(2-fluorophenyl)-hydroxymethyl]amino]piperidine-2,6-dione (PubChem CID 177240512) has the molecular formula C12H13FN2O3 and a molecular weight of 252.25 g/mol. Its IUPAC name is 3-[[(2-fluorophenyl)-hydroxymethyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[(2-fluorophenyl)-hydroxymethyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177240512 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-[[(2-fluorophenyl)-hydroxymethyl]amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(NC(O)c2ccccc2F)C(=O)N1 |
| InChI | InChI=1S/C12H13FN2O3/c13-8-4-2-1-3-7(8)11(17)14-9-5-6-10(16)15-12(9)18/h1-4,9,11,14,17H,5-6H2,(H,15,16,18) |
| InChIKey | XWRIEFJNUGOFNO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|