C29H39N3O5 — CID 155036974
N-[5-[[6-(2,6-dioxopiperidin-3-yl)-5,9-dioxo-7,8-dihydro-6H-benzo[7]annulen-1-yl]amino]pentyl]-3-(1-methylcyclobutyl)propanamide (PubChem CID 155036974) has the molecular formula C29H39N3O5 and a molecular weight of 509.65 g/mol. Its IUPAC name is N-[5-[[6-(2,6-dioxopiperidin-3-yl)-5,9-dioxo-7,8-dihydro-6H-benzo[7]annulen-1-yl]amino]pentyl]-3-(1-methylcyclobutyl)propanamide.
| Compound Name | N-[5-[[6-(2,6-dioxopiperidin-3-yl)-5,9-dioxo-7,8-dihydro-6H-benzo[7]annulen-1-yl]amino]pentyl]-3-(1-methylcyclobutyl)propanamide |
|---|---|
| PubChem CID | 155036974 |
| Molecular Formula | C29H39N3O5 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | N-[5-[[6-(2,6-dioxopiperidin-3-yl)-5,9-dioxo-7,8-dihydro-6H-benzo[7]annulen-1-yl]amino]pentyl]-3-(1-methylcyclobutyl)propanamide |
| SMILES | CC1(CCC(=O)NCCCCCNc2cccc3c2C(=O)CCC(C2CCC(=O)NC2=O)C3=O)CCC1 |
| InChI | InChI=1S/C29H39N3O5/c1-29(14-6-15-29)16-13-24(34)31-18-4-2-3-17-30-22-8-5-7-21-26(22)23(33)11-9-19(27(21)36)20-10-12-25(35)32-28(20)37/h5,7-8,19-20,30H,2-4,6,9-18H2,1H3,(H,31,34)(H,32,35,37) |
| InChIKey | DTAZZMBAJKFKHQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|