C24H32N4O5 — CID 175828828
N-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-4H-isoquinolin-5-yl]amino]octyl]acetamide (PubChem CID 175828828) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is N-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-4H-isoquinolin-5-yl]amino]octyl]acetamide.
| Compound Name | N-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-4H-isoquinolin-5-yl]amino]octyl]acetamide |
|---|---|
| PubChem CID | 175828828 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | N-[8-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-4H-isoquinolin-5-yl]amino]octyl]acetamide |
| SMILES | CC(=O)NCCCCCCCCNc1cccc2c1CC(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H32N4O5/c1-16(29)25-13-6-4-2-3-5-7-14-26-19-10-8-9-17-18(19)15-22(31)28(24(17)33)20-11-12-21(30)27-23(20)32/h8-10,20,26H,2-7,11-15H2,1H3,(H,25,29)(H,27,30,32) |
| InChIKey | JDAIIEUCNYHSNC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|