C30H44N4O6 — CID 147975273
N-[11-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-10-oxoundecyl]-2-[(2-methylpropan-2-yl)oxy]acetamide (PubChem CID 147975273) has the molecular formula C30H44N4O6 and a molecular weight of 556.70 g/mol. Its IUPAC name is N-[11-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-10-oxoundecyl]-2-[(2-methylpropan-2-yl)oxy]acetamide.
| Compound Name | N-[11-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-10-oxoundecyl]-2-[(2-methylpropan-2-yl)oxy]acetamide |
|---|---|
| PubChem CID | 147975273 |
| Molecular Formula | C30H44N4O6 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | N-[11-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-10-oxoundecyl]-2-[(2-methylpropan-2-yl)oxy]acetamide |
| SMILES | CC(C)(C)OCC(=O)NCCCCCCCCCC(=O)CNc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C30H44N4O6/c1-30(2,3)40-20-27(37)31-17-10-8-6-4-5-7-9-12-21(35)18-32-24-14-11-13-22-23(24)19-34(29(22)39)25-15-16-26(36)33-28(25)38/h11,13-14,25,32H,4-10,12,15-20H2,1-3H3,(H,31,37)(H,33,36,38) |
| InChIKey | ISDQSHYPKGDTEA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|