C14H19N3O3S — CID 156745130
N-(3-formylthiophen-2-yl)acetamide;3-(methylamino)-6-methylidenepiperidin-2-one (PubChem CID 156745130) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(3-formylthiophen-2-yl)acetamide;3-(methylamino)-6-methylidenepiperidin-2-one.
| Compound Name | N-(3-formylthiophen-2-yl)acetamide;3-(methylamino)-6-methylidenepiperidin-2-one |
|---|---|
| PubChem CID | 156745130 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-(3-formylthiophen-2-yl)acetamide;3-(methylamino)-6-methylidenepiperidin-2-one |
| SMILES | C=C1CCC(NC)C(=O)N1.CC(=O)Nc1sccc1C=O |
| InChI | InChI=1S/C7H12N2O.C7H7NO2S/c1-5-3-4-6(8-2)7(10)9-5;1-5(10)8-7-6(4-9)2-3-11-7/h6,8H,1,3-4H2,2H3,(H,9,10);2-4H,1H3,(H,8,10) |
| InChIKey | SDFHEBZXBIQHEL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|