About methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate
methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate (PubChem CID 10680716) has the molecular formula C10H11NO3S
and a molecular weight of 225.27 g/mol. Its IUPAC name is methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate.
Analyze methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate?
The IUPAC name of methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate (CID 10680716) is methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate.
What is the SMILES notation for methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate?
The canonical SMILES for methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate is COC(=O)NC1CCc2sccc2C1=O.
What is the InChIKey of methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate?
The InChIKey is OFTUQYJVAXJNOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3S/c1-14-10(13)11-7-2-3-8-6(9(7)12)4-5-15-8/h4-5,7H,2-3H2,1H3,(H,11,13).
What are the key properties of methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate?
methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate has a molecular weight of 225.27 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(4-oxo-6,7-dihydro-5H-1-benzothiophen-5-yl)carbamate is sourced from PubChem (CID 10680716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).