C15H13NO2S — CID 163822022
4-oxo-N-phenyl-6,7-dihydro-5H-1-benzothiophene-5-carboxamide (PubChem CID 163822022) has the molecular formula C15H13NO2S and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-oxo-N-phenyl-6,7-dihydro-5H-1-benzothiophene-5-carboxamide.
| Compound Name | 4-oxo-N-phenyl-6,7-dihydro-5H-1-benzothiophene-5-carboxamide |
|---|---|
| PubChem CID | 163822022 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 4-oxo-N-phenyl-6,7-dihydro-5H-1-benzothiophene-5-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCc2sccc2C1=O |
| InChI | InChI=1S/C15H13NO2S/c17-14-11-8-9-19-13(11)7-6-12(14)15(18)16-10-4-2-1-3-5-10/h1-5,8-9,12H,6-7H2,(H,16,18) |
| InChIKey | NWFHUUGHJXWXFK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|