C14H17NO3S — CID 46742696
tert-butyl N-(4-oxo-2,3-dihydrothiochromen-3-yl)carbamate (PubChem CID 46742696) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is tert-butyl N-(4-oxo-2,3-dihydrothiochromen-3-yl)carbamate.
| Compound Name | tert-butyl N-(4-oxo-2,3-dihydrothiochromen-3-yl)carbamate |
|---|---|
| PubChem CID | 46742696 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | tert-butyl N-(4-oxo-2,3-dihydrothiochromen-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CSc2ccccc2C1=O |
| InChI | InChI=1S/C14H17NO3S/c1-14(2,3)18-13(17)15-10-8-19-11-7-5-4-6-9(11)12(10)16/h4-7,10H,8H2,1-3H3,(H,15,17) |
| InChIKey | LSEJWLBGLGHXLN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |