C24H23N3O2S — CID 102469512
tert-butyl N-[(R)-[(3S)-4-(dicyanomethylidene)-2,3-dihydrothiochromen-3-yl]-phenylmethyl]carbamate (PubChem CID 102469512) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is tert-butyl N-[(R)-[(3S)-4-(dicyanomethylidene)-2,3-dihydrothiochromen-3-yl]-phenylmethyl]carbamate.
| Compound Name | tert-butyl N-[(R)-[(3S)-4-(dicyanomethylidene)-2,3-dihydrothiochromen-3-yl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 102469512 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | tert-butyl N-[(R)-[(3S)-4-(dicyanomethylidene)-2,3-dihydrothiochromen-3-yl]-phenylmethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccccc1)[C@H]1CSc2ccccc2C1=C(C#N)C#N |
| InChI | InChI=1S/C24H23N3O2S/c1-24(2,3)29-23(28)27-22(16-9-5-4-6-10-16)19-15-30-20-12-8-7-11-18(20)21(19)17(13-25)14-26/h4-12,19,22H,15H2,1-3H3,(H,27,28)/t19-,22-/m0/s1 |
| InChIKey | ULMFGMSFNVQHFW-UGKGYDQZSA-N |
| XLogP | 5.48 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|