C21H25N3O2 — CID 102469524
tert-butyl N-[(R)-[(1S)-2-(dicyanomethylidene)cyclohexyl]-phenylmethyl]carbamate (PubChem CID 102469524) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is tert-butyl N-[(R)-[(1S)-2-(dicyanomethylidene)cyclohexyl]-phenylmethyl]carbamate.
| Compound Name | tert-butyl N-[(R)-[(1S)-2-(dicyanomethylidene)cyclohexyl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 102469524 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | tert-butyl N-[(R)-[(1S)-2-(dicyanomethylidene)cyclohexyl]-phenylmethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccccc1)[C@H]1CCCCC1=C(C#N)C#N |
| InChI | InChI=1S/C21H25N3O2/c1-21(2,3)26-20(25)24-19(15-9-5-4-6-10-15)18-12-8-7-11-17(18)16(13-22)14-23/h4-6,9-10,18-19H,7-8,11-12H2,1-3H3,(H,24,25)/t18-,19-/m0/s1 |
| InChIKey | XAGJOPYAACTEDT-OALUTQOASA-N |
| XLogP | 4.79 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|