C8H9NOS — CID 165358616
N-(3-ethenylthiophen-2-yl)acetamide (PubChem CID 165358616) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. Its IUPAC name is N-(3-ethenylthiophen-2-yl)acetamide.
| Compound Name | N-(3-ethenylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 165358616 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | N-(3-ethenylthiophen-2-yl)acetamide |
| SMILES | C=Cc1ccsc1NC(C)=O |
| InChI | InChI=1S/C8H9NOS/c1-3-7-4-5-11-8(7)9-6(2)10/h3-5H,1H2,2H3,(H,9,10) |
| InChIKey | IMCHOQUDGPSOBU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |