C17H22N2O3 — CID 176531257
2-[1-[(2,6-dioxopiperidin-3-yl)amino]propa-1,2-dienyl]benzaldehyde;ethane;molecular hydrogen (PubChem CID 176531257) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-[1-[(2,6-dioxopiperidin-3-yl)amino]propa-1,2-dienyl]benzaldehyde;ethane;molecular hydrogen.
| Compound Name | 2-[1-[(2,6-dioxopiperidin-3-yl)amino]propa-1,2-dienyl]benzaldehyde;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 176531257 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[1-[(2,6-dioxopiperidin-3-yl)amino]propa-1,2-dienyl]benzaldehyde;ethane;molecular hydrogen |
| SMILES | C=C=C(NC1CCC(=O)NC1=O)c1ccccc1C=O.CC.[H][H] |
| InChI | InChI=1S/C15H14N2O3.C2H6.H2/c1-2-12(11-6-4-3-5-10(11)9-18)16-13-7-8-14(19)17-15(13)20;1-2;/h3-6,9,13,16H,1,7-8H2,(H,17,19,20);1-2H3;1H |
| InChIKey | QHHYVCHQQSSRPB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|