C25H29N3O6 — CID 166982444
tert-butyl 4-[2-[3-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-formylphenyl]ethynyl]piperidine-1-carboxylate (PubChem CID 166982444) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-formylphenyl]ethynyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-formylphenyl]ethynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166982444 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | tert-butyl 4-[2-[3-[(2,6-dioxopiperidin-3-yl)carbamoyl]-2-formylphenyl]ethynyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#Cc2cccc(C(=O)NC3CCC(=O)NC3=O)c2C=O)CC1 |
| InChI | InChI=1S/C25H29N3O6/c1-25(2,3)34-24(33)28-13-11-16(12-14-28)7-8-17-5-4-6-18(19(17)15-29)22(31)26-20-9-10-21(30)27-23(20)32/h4-6,15-16,20H,9-14H2,1-3H3,(H,26,31)(H,27,30,32) |
| InChIKey | VLTLZNHLQYLODK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|