C26H34N4O5 — CID 177072798
tert-butyl 4-[3-[3-(2,6-dioxopiperidine-3-carboximidoyl)-2-(methylamino)phenyl]prop-2-ynoxy]piperidine-1-carboxylate (PubChem CID 177072798) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is tert-butyl 4-[3-[3-(2,6-dioxopiperidine-3-carboximidoyl)-2-(methylamino)phenyl]prop-2-ynoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[3-(2,6-dioxopiperidine-3-carboximidoyl)-2-(methylamino)phenyl]prop-2-ynoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177072798 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | tert-butyl 4-[3-[3-(2,6-dioxopiperidine-3-carboximidoyl)-2-(methylamino)phenyl]prop-2-ynoxy]piperidine-1-carboxylate |
| SMILES | [H]/N=C(/c1cccc(C#CCOC2CCN(C(=O)OC(C)(C)C)CC2)c1NC)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C26H34N4O5/c1-26(2,3)35-25(33)30-14-12-18(13-15-30)34-16-6-8-17-7-5-9-19(23(17)28-4)22(27)20-10-11-21(31)29-24(20)32/h5,7,9,18,20,27-28H,10-16H2,1-4H3,(H,29,31,32)/b27-22- |
| InChIKey | VZQSLQVIIFDZNA-QYQHSDTDSA-N |
| XLogP | 2.92 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|