C20H26F2N4O2 — CID 176933242
3-[3-[2-(3,3-difluoropiperidin-1-yl)ethyl]-2-(methylamino)benzenecarboximidoyl]piperidine-2,6-dione (PubChem CID 176933242) has the molecular formula C20H26F2N4O2 and a molecular weight of 392.45 g/mol. Its IUPAC name is 3-[3-[2-(3,3-difluoropiperidin-1-yl)ethyl]-2-(methylamino)benzenecarboximidoyl]piperidine-2,6-dione.
| Compound Name | 3-[3-[2-(3,3-difluoropiperidin-1-yl)ethyl]-2-(methylamino)benzenecarboximidoyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176933242 |
| Molecular Formula | C20H26F2N4O2 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 3-[3-[2-(3,3-difluoropiperidin-1-yl)ethyl]-2-(methylamino)benzenecarboximidoyl]piperidine-2,6-dione |
| SMILES | [H]/N=C(/c1cccc(CCN2CCCC(F)(F)C2)c1NC)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C20H26F2N4O2/c1-24-18-13(8-11-26-10-3-9-20(21,22)12-26)4-2-5-14(18)17(23)15-6-7-16(27)25-19(15)28/h2,4-5,15,23-24H,3,6-12H2,1H3,(H,25,27,28)/b23-17- |
| InChIKey | PZMAGQFMDDENQN-QJOMJCCJSA-N |
| XLogP | 2.42 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|