C18H22FN3O3 — CID 169097488
N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-(piperidin-1-ylmethyl)benzamide (PubChem CID 169097488) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-(piperidin-1-ylmethyl)benzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-(piperidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 169097488 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-(piperidin-1-ylmethyl)benzamide |
| SMILES | O=C1CCC(NC(=O)c2cccc(CN3CCCCC3)c2F)C(=O)N1 |
| InChI | InChI=1S/C18H22FN3O3/c19-16-12(11-22-9-2-1-3-10-22)5-4-6-13(16)17(24)20-14-7-8-15(23)21-18(14)25/h4-6,14H,1-3,7-11H2,(H,20,24)(H,21,23,25) |
| InChIKey | UDSNAPPRZJKUPY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|