C17H18FN3O4S — CID 169097487
N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-[(3-oxothiomorpholin-4-yl)methyl]benzamide (PubChem CID 169097487) has the molecular formula C17H18FN3O4S and a molecular weight of 379.41 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-[(3-oxothiomorpholin-4-yl)methyl]benzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-[(3-oxothiomorpholin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 169097487 |
| Molecular Formula | C17H18FN3O4S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-[(3-oxothiomorpholin-4-yl)methyl]benzamide |
| SMILES | O=C1CCC(NC(=O)c2cccc(CN3CCSCC3=O)c2F)C(=O)N1 |
| InChI | InChI=1S/C17H18FN3O4S/c18-15-10(8-21-6-7-26-9-14(21)23)2-1-3-11(15)16(24)19-12-4-5-13(22)20-17(12)25/h1-3,12H,4-9H2,(H,19,24)(H,20,22,25) |
| InChIKey | UHRCRSUEYNVYCE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|