C17H20FN3O4 — CID 169097482
N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-(morpholin-4-ylmethyl)benzamide (PubChem CID 169097482) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-(morpholin-4-ylmethyl)benzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 169097482 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-fluoro-3-(morpholin-4-ylmethyl)benzamide |
| SMILES | O=C1CCC(NC(=O)c2cccc(CN3CCOCC3)c2F)C(=O)N1 |
| InChI | InChI=1S/C17H20FN3O4/c18-15-11(10-21-6-8-25-9-7-21)2-1-3-12(15)16(23)19-13-4-5-14(22)20-17(13)24/h1-3,13H,4-10H2,(H,19,23)(H,20,22,24) |
| InChIKey | JQIWXIQIOUHWJM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|