C19H23FN2O6 — CID 171843869
tert-butyl 2-[3-[(2,7-dioxoazepan-3-yl)carbamoyl]-2-fluorophenoxy]acetate (PubChem CID 171843869) has the molecular formula C19H23FN2O6 and a molecular weight of 394.40 g/mol. Its IUPAC name is tert-butyl 2-[3-[(2,7-dioxoazepan-3-yl)carbamoyl]-2-fluorophenoxy]acetate.
| Compound Name | tert-butyl 2-[3-[(2,7-dioxoazepan-3-yl)carbamoyl]-2-fluorophenoxy]acetate |
|---|---|
| PubChem CID | 171843869 |
| Molecular Formula | C19H23FN2O6 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | tert-butyl 2-[3-[(2,7-dioxoazepan-3-yl)carbamoyl]-2-fluorophenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1cccc(C(=O)NC2CCCC(=O)NC2=O)c1F |
| InChI | InChI=1S/C19H23FN2O6/c1-19(2,3)28-15(24)10-27-13-8-4-6-11(16(13)20)17(25)21-12-7-5-9-14(23)22-18(12)26/h4,6,8,12H,5,7,9-10H2,1-3H3,(H,21,25)(H,22,23,26) |
| InChIKey | QFZGPABYHSLHGB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|