C16H22N3O3+ — CID 91000885
1-(diazonioamino)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-1,2,3,4-tetrahydronaphthalene (PubChem CID 91000885) has the molecular formula C16H22N3O3+ and a molecular weight of 304.37 g/mol. Its IUPAC name is 1-(diazonioamino)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(diazonioamino)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 91000885 |
| Molecular Formula | C16H22N3O3+ |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-(diazonioamino)-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)(C)OC(=O)COc1cccc2c1CCCC2N[N+]#N |
| InChI | InChI=1S/C16H22N3O3/c1-16(2,3)22-15(20)10-21-14-9-5-6-11-12(14)7-4-8-13(11)18-19-17/h5-6,9,13,18H,4,7-8,10H2,1-3H3/q+1 |
| InChIKey | JDIUAYTZPHAVFD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|