C18H24N4O2 — CID 156518135
3-[2-(methylamino)-4-piperidin-4-ylbenzenecarboximidoyl]piperidine-2,6-dione (PubChem CID 156518135) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-[2-(methylamino)-4-piperidin-4-ylbenzenecarboximidoyl]piperidine-2,6-dione.
| Compound Name | 3-[2-(methylamino)-4-piperidin-4-ylbenzenecarboximidoyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156518135 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 3-[2-(methylamino)-4-piperidin-4-ylbenzenecarboximidoyl]piperidine-2,6-dione |
| SMILES | [H]/N=C(/c1ccc(C2CCNCC2)cc1NC)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H24N4O2/c1-20-15-10-12(11-6-8-21-9-7-11)2-3-13(15)17(19)14-4-5-16(23)22-18(14)24/h2-3,10-11,14,19-21H,4-9H2,1H3,(H,22,23,24)/b19-17- |
| InChIKey | IAWRATSDKOPWBT-ZPHPHTNESA-N |
| XLogP | 1.62 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|