C16H22N6O2 — CID 177155602
1-[2-(methylamino)-4-piperazin-1-ylbenzenecarboximidoyl]-1,3-diazinane-2,4-dione (PubChem CID 177155602) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[2-(methylamino)-4-piperazin-1-ylbenzenecarboximidoyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-(methylamino)-4-piperazin-1-ylbenzenecarboximidoyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177155602 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-[2-(methylamino)-4-piperazin-1-ylbenzenecarboximidoyl]-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C(/c1ccc(N2CCNCC2)cc1NC)N1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H22N6O2/c1-18-13-10-11(21-8-5-19-6-9-21)2-3-12(13)15(17)22-7-4-14(23)20-16(22)24/h2-3,10,17-19H,4-9H2,1H3,(H,20,23,24)/b17-15- |
| InChIKey | KQYIEFLRGOZBCS-ICFOKQHNSA-N |
| XLogP | 0.41 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|