C23H35N5O2 — CID 170979488
N-acetyl-2-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(methylamino)benzenecarboximidoyl]butanamide (PubChem CID 170979488) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N-acetyl-2-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(methylamino)benzenecarboximidoyl]butanamide.
| Compound Name | N-acetyl-2-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(methylamino)benzenecarboximidoyl]butanamide |
|---|---|
| PubChem CID | 170979488 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | N-acetyl-2-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-(methylamino)benzenecarboximidoyl]butanamide |
| SMILES | [H]/N=C(/c1ccc(N2CCC3(CCNCC3)CC2)cc1NC)C(CC)C(=O)NC(C)=O |
| InChI | InChI=1S/C23H35N5O2/c1-4-18(22(30)27-16(2)29)21(24)19-6-5-17(15-20(19)25-3)28-13-9-23(10-14-28)7-11-26-12-8-23/h5-6,15,18,24-26H,4,7-14H2,1-3H3,(H,27,29,30)/b24-21+ |
| InChIKey | QJEYHQGUGHBWQE-DARPEHSRSA-N |
| XLogP | 2.76 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|