C24H33FN6O3 — CID 178161560
4-[[1-[5-(2,6-dioxopiperidine-3-carboximidoyl)-3-fluoro-4-(methylamino)-2-pyridinyl]piperidin-4-yl]methyl]piperidine-1-carbaldehyde (PubChem CID 178161560) has the molecular formula C24H33FN6O3 and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-[[1-[5-(2,6-dioxopiperidine-3-carboximidoyl)-3-fluoro-4-(methylamino)-2-pyridinyl]piperidin-4-yl]methyl]piperidine-1-carbaldehyde.
| Compound Name | 4-[[1-[5-(2,6-dioxopiperidine-3-carboximidoyl)-3-fluoro-4-(methylamino)-2-pyridinyl]piperidin-4-yl]methyl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 178161560 |
| Molecular Formula | C24H33FN6O3 |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 4-[[1-[5-(2,6-dioxopiperidine-3-carboximidoyl)-3-fluoro-4-(methylamino)-2-pyridinyl]piperidin-4-yl]methyl]piperidine-1-carbaldehyde |
| SMILES | [H]/N=C(/c1cnc(N2CCC(CC3CCN(C=O)CC3)CC2)c(F)c1NC)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H33FN6O3/c1-27-22-18(21(26)17-2-3-19(33)29-24(17)34)13-28-23(20(22)25)31-10-6-16(7-11-31)12-15-4-8-30(14-32)9-5-15/h13-17,26H,2-12H2,1H3,(H,27,28)(H,29,33,34)/b26-21+ |
| InChIKey | QZJKYWGXUOIVMI-YYADALCUSA-N |
| XLogP | 2.16 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|