C24H28N4O5 — CID 166648900
3-[6-[2-(4-acetylpiperazin-1-yl)ethoxy]-2-hydroxynaphthalene-1-carboximidoyl]piperidine-2,6-dione (PubChem CID 166648900) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 3-[6-[2-(4-acetylpiperazin-1-yl)ethoxy]-2-hydroxynaphthalene-1-carboximidoyl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-(4-acetylpiperazin-1-yl)ethoxy]-2-hydroxynaphthalene-1-carboximidoyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166648900 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-[6-[2-(4-acetylpiperazin-1-yl)ethoxy]-2-hydroxynaphthalene-1-carboximidoyl]piperidine-2,6-dione |
| SMILES | [H]/N=C(/c1c(O)ccc2cc(OCCN3CCN(C(C)=O)CC3)ccc12)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H28N4O5/c1-15(29)28-10-8-27(9-11-28)12-13-33-17-3-4-18-16(14-17)2-6-20(30)22(18)23(25)19-5-7-21(31)26-24(19)32/h2-4,6,14,19,25,30H,5,7-13H2,1H3,(H,26,31,32)/b25-23+ |
| InChIKey | HKYPDGDECMOOHI-WJTDDFOZSA-N |
| XLogP | 1.51 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|