C29H33N3O6 — CID 175626102
tert-butyl 4-[3-[5-(2,6-dioxopiperidine-3-carboximidoyl)-6-hydroxynaphthalen-2-yl]prop-2-ynoxy]piperidine-1-carboxylate (PubChem CID 175626102) has the molecular formula C29H33N3O6 and a molecular weight of 519.60 g/mol. Its IUPAC name is tert-butyl 4-[3-[5-(2,6-dioxopiperidine-3-carboximidoyl)-6-hydroxynaphthalen-2-yl]prop-2-ynoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[5-(2,6-dioxopiperidine-3-carboximidoyl)-6-hydroxynaphthalen-2-yl]prop-2-ynoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175626102 |
| Molecular Formula | C29H33N3O6 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | tert-butyl 4-[3-[5-(2,6-dioxopiperidine-3-carboximidoyl)-6-hydroxynaphthalen-2-yl]prop-2-ynoxy]piperidine-1-carboxylate |
| SMILES | [H]/N=C(/c1c(O)ccc2cc(C#CCOC3CCN(C(=O)OC(C)(C)C)CC3)ccc12)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C29H33N3O6/c1-29(2,3)38-28(36)32-14-12-20(13-15-32)37-16-4-5-18-6-8-21-19(17-18)7-10-23(33)25(21)26(30)22-9-11-24(34)31-27(22)35/h6-8,10,17,20,22,30,33H,9,11-16H2,1-3H3,(H,31,34,35)/b30-26+ |
| InChIKey | VUFFRIYISNELCR-URGPHPNLSA-N |
| XLogP | 3.73 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|