C15H20N2O4S — CID 144947844
ethane;methyl 2-[(2,6-dioxopiperidin-3-yl)amino]sulfanylbenzoate (PubChem CID 144947844) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is ethane;methyl 2-[(2,6-dioxopiperidin-3-yl)amino]sulfanylbenzoate.
| Compound Name | ethane;methyl 2-[(2,6-dioxopiperidin-3-yl)amino]sulfanylbenzoate |
|---|---|
| PubChem CID | 144947844 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | ethane;methyl 2-[(2,6-dioxopiperidin-3-yl)amino]sulfanylbenzoate |
| SMILES | CC.COC(=O)c1ccccc1SNC1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H14N2O4S.C2H6/c1-19-13(18)8-4-2-3-5-10(8)20-15-9-6-7-11(16)14-12(9)17;1-2/h2-5,9,15H,6-7H2,1H3,(H,14,16,17);1-2H3 |
| InChIKey | CYZYOQKZAANSNB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|