C13H14N2O4 — CID 62026931
methyl 2-[(2,5-dioxopyrrolidin-3-yl)-methylamino]benzoate (PubChem CID 62026931) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl 2-[(2,5-dioxopyrrolidin-3-yl)-methylamino]benzoate.
| Compound Name | methyl 2-[(2,5-dioxopyrrolidin-3-yl)-methylamino]benzoate |
|---|---|
| PubChem CID | 62026931 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | methyl 2-[(2,5-dioxopyrrolidin-3-yl)-methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)C1CC(=O)NC1=O |
| InChI | InChI=1S/C13H14N2O4/c1-15(10-7-11(16)14-12(10)17)9-6-4-3-5-8(9)13(18)19-2/h3-6,10H,7H2,1-2H3,(H,14,16,17) |
| InChIKey | ZCWFGFXOXIJPAU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|