C20H22ClN5O2 — CID 163916472
(Z)-2-amino-3-[amino(benzyl)amino]-N-(8-chloro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)prop-2-enamide (PubChem CID 163916472) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino(benzyl)amino]-N-(8-chloro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)prop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino(benzyl)amino]-N-(8-chloro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 163916472 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (Z)-2-amino-3-[amino(benzyl)amino]-N-(8-chloro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)prop-2-enamide |
| SMILES | N/C(=C\N(N)Cc1ccccc1)C(=O)NC1CCc2ccc(Cl)cc2NC1=O |
| InChI | InChI=1S/C20H22ClN5O2/c21-15-8-6-14-7-9-17(20(28)25-18(14)10-15)24-19(27)16(22)12-26(23)11-13-4-2-1-3-5-13/h1-6,8,10,12,17H,7,9,11,22-23H2,(H,24,27)(H,25,28)/b16-12- |
| InChIKey | QWRRFVJYHNCAOA-VBKFSLOCSA-N |
| XLogP | 1.89 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|