C20H22N4O2 — CID 134354170
(Z)-2-amino-3-(benzylamino)-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)prop-2-enamide (PubChem CID 134354170) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is (Z)-2-amino-3-(benzylamino)-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)prop-2-enamide.
| Compound Name | (Z)-2-amino-3-(benzylamino)-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 134354170 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (Z)-2-amino-3-(benzylamino)-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)prop-2-enamide |
| SMILES | N/C(=C\NCc1ccccc1)C(=O)NC1CCc2ccccc2NC1=O |
| InChI | InChI=1S/C20H22N4O2/c21-16(13-22-12-14-6-2-1-3-7-14)19(25)24-18-11-10-15-8-4-5-9-17(15)23-20(18)26/h1-9,13,18,22H,10-12,21H2,(H,23,26)(H,24,25)/b16-13- |
| InChIKey | INRQBDNQCCZZQY-SSZFMOIBSA-N |
| XLogP | 1.65 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|