C23H24FN3O2 — CID 134354099
(Z)-4-[(2-fluorophenyl)methylamino]-2-methylidene-N-[(3S)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]pent-3-enamide (PubChem CID 134354099) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is (Z)-4-[(2-fluorophenyl)methylamino]-2-methylidene-N-[(3S)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]pent-3-enamide.
| Compound Name | (Z)-4-[(2-fluorophenyl)methylamino]-2-methylidene-N-[(3S)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]pent-3-enamide |
|---|---|
| PubChem CID | 134354099 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (Z)-4-[(2-fluorophenyl)methylamino]-2-methylidene-N-[(3S)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]pent-3-enamide |
| SMILES | C=C(/C=C(/C)NCc1ccccc1F)C(=O)N[C@H]1CCc2ccccc2NC1=O |
| InChI | InChI=1S/C23H24FN3O2/c1-15(13-16(2)25-14-18-8-3-5-9-19(18)24)22(28)27-21-12-11-17-7-4-6-10-20(17)26-23(21)29/h3-10,13,21,25H,1,11-12,14H2,2H3,(H,26,29)(H,27,28)/b16-13-/t21-/m0/s1 |
| InChIKey | AURIMBWTRQSWAQ-XHVGKJTDSA-N |
| XLogP | 3.44 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|