C20H31N4O3W- — CID 156866610
1,4-dimethylpiperazine;(2E,5Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidenehepta-3,5-dienamide;tungsten (PubChem CID 156866610) has the molecular formula C20H31N4O3W- and a molecular weight of 559.33 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;(2E,5Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidenehepta-3,5-dienamide;tungsten.
| Compound Name | 1,4-dimethylpiperazine;(2E,5Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidenehepta-3,5-dienamide;tungsten |
|---|---|
| PubChem CID | 156866610 |
| Molecular Formula | C20H31N4O3W- |
| Molecular Weight | 559.33 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 1,4-dimethylpiperazine;(2E,5Z)-N-(2,6-dioxopiperidin-3-yl)-2-ethylidenehepta-3,5-dienamide;tungsten |
| SMILES | C/C=C\C=[C-]\C(=C/C)C(=O)NC1CCC(=O)NC1=O.CN1CCN(C)CC1.[W] |
| InChI | InChI=1S/C14H17N2O3.C6H14N2.W/c1-3-5-6-7-10(4-2)13(18)15-11-8-9-12(17)16-14(11)19;1-7-3-5-8(2)6-4-7;/h3-6,11H,8-9H2,1-2H3,(H,15,18)(H,16,17,19);3-6H2,1-2H3;/q-1;;/b5-3-,10-4+;; |
| InChIKey | FBZUUVRQLSPMRX-QHRWHYLHSA-N |
| XLogP | 0.65 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|