C14H18N2O3 — CID 103822664
N-(2,6-dioxopiperidin-3-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 103822664) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 103822664 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | O=C1CCC(NC(=O)C2C3C4CCC(C4)C23)C(=O)N1 |
| InChI | InChI=1S/C14H18N2O3/c17-9-4-3-8(13(18)16-9)15-14(19)12-10-6-1-2-7(5-6)11(10)12/h6-8,10-12H,1-5H2,(H,15,19)(H,16,17,18) |
| InChIKey | XBOPCTONZSTUHM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|